C29H32FN5O6S — CID 71233944
N-[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 71233944) has the molecular formula C29H32FN5O6S and a molecular weight of 597.67 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71233944 |
| Molecular Formula | C29H32FN5O6S |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-5-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1ccc(N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C29H32FN5O6S/c30-22-7-9-23(10-8-22)42(39,40)35-17-15-33(16-18-35)25-11-6-21(20-24(25)32-29(38)26-4-2-19-41-26)28(37)31-12-3-14-34-13-1-5-27(34)36/h2,4,6-11,19-20H,1,3,5,12-18H2,(H,31,37)(H,32,38) |
| InChIKey | IZRIKALPSOXNTI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|