C10H12N2O4 — CID 71238219
2-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-nitropyridine (PubChem CID 71238219) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-nitropyridine.
| Compound Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-nitropyridine |
|---|---|
| PubChem CID | 71238219 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-5-nitropyridine |
| SMILES | CC1(C)OCC(c2ccc([N+](=O)[O-])cn2)O1 |
| InChI | InChI=1S/C10H12N2O4/c1-10(2)15-6-9(16-10)8-4-3-7(5-11-8)12(13)14/h3-5,9H,6H2,1-2H3 |
| InChIKey | AVSZFZUKLWAMSD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|