C16H14ClFN2O5S — CID 71239096
2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N-methyl-1-oxo-3H-isoindole-4-sulfonamide (PubChem CID 71239096) has the molecular formula C16H14ClFN2O5S and a molecular weight of 400.82 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N-methyl-1-oxo-3H-isoindole-4-sulfonamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N-methyl-1-oxo-3H-isoindole-4-sulfonamide |
|---|---|
| PubChem CID | 71239096 |
| Molecular Formula | C16H14ClFN2O5S |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N-methyl-1-oxo-3H-isoindole-4-sulfonamide |
| SMILES | CNS(=O)(=O)c1cc(O)c(O)c2c1CN(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C16H14ClFN2O5S/c1-19-26(24,25)13-5-12(21)15(22)14-9(13)7-20(16(14)23)6-8-2-3-11(18)10(17)4-8/h2-5,19,21-22H,6-7H2,1H3 |
| InChIKey | MHQLCRRZRKKSLG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|