C21H24ClFN4O5S — CID 71238973
4-[4-(2-aminoethyl)piperazin-1-yl]sulfonyl-2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one (PubChem CID 71238973) has the molecular formula C21H24ClFN4O5S and a molecular weight of 498.96 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)piperazin-1-yl]sulfonyl-2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one.
| Compound Name | 4-[4-(2-aminoethyl)piperazin-1-yl]sulfonyl-2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 71238973 |
| Molecular Formula | C21H24ClFN4O5S |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-[4-(2-aminoethyl)piperazin-1-yl]sulfonyl-2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
| SMILES | NCCN1CCN(S(=O)(=O)c2cc(O)c(O)c3c2CN(Cc2ccc(F)c(Cl)c2)C3=O)CC1 |
| InChI | InChI=1S/C21H24ClFN4O5S/c22-15-9-13(1-2-16(15)23)11-26-12-14-18(10-17(28)20(29)19(14)21(26)30)33(31,32)27-7-5-25(4-3-24)6-8-27/h1-2,9-10,28-29H,3-8,11-12,24H2 |
| InChIKey | AZJWHUQNLDVIEL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|