C19H25NO — CID 7123925
(1S,4S)-N-(3,4-dimethylphenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 7123925) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is (1S,4S)-N-(3,4-dimethylphenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4S)-N-(3,4-dimethylphenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 7123925 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1S,4S)-N-(3,4-dimethylphenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@H]2CC[C@]1(C(=O)Nc1ccc(C)c(C)c1)C2 |
| InChI | InChI=1S/C19H25NO/c1-12-6-7-16(10-13(12)2)20-17(21)19-9-8-15(11-19)18(4,5)14(19)3/h6-7,10,15H,3,8-9,11H2,1-2,4-5H3,(H,20,21)/t15-,19-/m0/s1 |
| InChIKey | RPJOGHFODHVZQO-KXBFYZLASA-N |
| XLogP | 4.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|