C54H42N4O4 — CID 71243186
2-[2-methoxy-4-[2,4,5-tris(3-methoxy-4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 71243186) has the molecular formula C54H42N4O4 and a molecular weight of 810.95 g/mol. Its IUPAC name is 2-[2-methoxy-4-[2,4,5-tris(3-methoxy-4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | 2-[2-methoxy-4-[2,4,5-tris(3-methoxy-4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 71243186 |
| Molecular Formula | C54H42N4O4 |
| Molecular Weight | 810.95 g/mol |
| Exact Mass | 810.32 |
| IUPAC Name | 2-[2-methoxy-4-[2,4,5-tris(3-methoxy-4-pyridin-2-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | COc1cc(-c2cc(-c3ccc(-c4ccccn4)c(OC)c3)c(-c3ccc(-c4ccccn4)c(OC)c3)cc2-c2ccc(-c3ccccn3)c(OC)c2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C54H42N4O4/c1-59-51-29-35(17-21-39(51)47-13-5-9-25-55-47)43-33-45(37-19-23-41(53(31-37)61-3)49-15-7-11-27-57-49)46(38-20-24-42(54(32-38)62-4)50-16-8-12-28-58-50)34-44(43)36-18-22-40(52(30-36)60-2)48-14-6-10-26-56-48/h5-34H,1-4H3 |
| InChIKey | WTVIOFCVSWJNQV-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.95 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |