C13H14N2O3S — CID 71244100
ethyl 2-[(4Z)-2-methyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-1-yl]acetate (PubChem CID 71244100) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is ethyl 2-[(4Z)-2-methyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-1-yl]acetate.
| Compound Name | ethyl 2-[(4Z)-2-methyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 71244100 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 2-[(4Z)-2-methyl-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)/C(=C/c2cccs2)N=C1C |
| InChI | InChI=1S/C13H14N2O3S/c1-3-18-12(16)8-15-9(2)14-11(13(15)17)7-10-5-4-6-19-10/h4-7H,3,8H2,1-2H3/b11-7- |
| InChIKey | KUSPZQSRTJRRCB-XFFZJAGNSA-N |
| XLogP | 1.91 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|