C12H14N2O2S — CID 71244099
(5Z)-3-(2-methoxyethyl)-2-methyl-5-(thiophen-2-ylmethylidene)imidazol-4-one (PubChem CID 71244099) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (5Z)-3-(2-methoxyethyl)-2-methyl-5-(thiophen-2-ylmethylidene)imidazol-4-one.
| Compound Name | (5Z)-3-(2-methoxyethyl)-2-methyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
|---|---|
| PubChem CID | 71244099 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (5Z)-3-(2-methoxyethyl)-2-methyl-5-(thiophen-2-ylmethylidene)imidazol-4-one |
| SMILES | COCCN1C(=O)/C(=C/c2cccs2)N=C1C |
| InChI | InChI=1S/C12H14N2O2S/c1-9-13-11(8-10-4-3-7-17-10)12(15)14(9)5-6-16-2/h3-4,7-8H,5-6H2,1-2H3/b11-8- |
| InChIKey | PHTHGYQBCPSFEL-FLIBITNWSA-N |
| XLogP | 2.00 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|