C15H11ClN2O3S — CID 71245897
3-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide (PubChem CID 71245897) has the molecular formula C15H11ClN2O3S and a molecular weight of 334.78 g/mol. Its IUPAC name is 3-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide.
| Compound Name | 3-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71245897 |
| Molecular Formula | C15H11ClN2O3S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-[(Z)-(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(/C=C2\C(=O)Nc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C15H11ClN2O3S/c16-10-4-5-12-13(15(19)18-14(12)8-10)7-9-2-1-3-11(6-9)22(17,20)21/h1-8H,(H,18,19)(H2,17,20,21)/b13-7- |
| InChIKey | AXRQOVLYTOBIBV-QPEQYQDCSA-N |
| XLogP | 2.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|