C10H18N2O4 — CID 71251227
methyl (3R)-4-hydroxy-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate (PubChem CID 71251227) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl (3R)-4-hydroxy-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl (3R)-4-hydroxy-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 71251227 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | methyl (3R)-4-hydroxy-3-[[(2S)-pyrrolidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)C[C@H](CO)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H18N2O4/c1-16-9(14)5-7(6-13)12-10(15)8-3-2-4-11-8/h7-8,11,13H,2-6H2,1H3,(H,12,15)/t7-,8+/m1/s1 |
| InChIKey | QZZMKKSQKKKLKV-SFYZADRCSA-N |
| XLogP | -1.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |