C9H16N2O4 — CID 118488825
[(1R)-2-hydroxy-1-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyl] acetate (PubChem CID 118488825) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is [(1R)-2-hydroxy-1-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyl] acetate.
| Compound Name | [(1R)-2-hydroxy-1-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyl] acetate |
|---|---|
| PubChem CID | 118488825 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | [(1R)-2-hydroxy-1-[[(2S)-pyrrolidine-2-carbonyl]amino]ethyl] acetate |
| SMILES | CC(=O)O[C@H](CO)NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C9H16N2O4/c1-6(13)15-8(5-12)11-9(14)7-3-2-4-10-7/h7-8,10,12H,2-5H2,1H3,(H,11,14)/t7-,8+/m0/s1 |
| InChIKey | ZNXZNEUGLUMJME-JGVFFNPUSA-N |
| XLogP | -1.26 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|