C16H13N5O2 — CID 71253361
3-methyl-1-(3-phenyl-1H-pyrazolo[3,4-c]pyridin-5-yl)imidazolidine-2,4-dione (PubChem CID 71253361) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 3-methyl-1-(3-phenyl-1H-pyrazolo[3,4-c]pyridin-5-yl)imidazolidine-2,4-dione.
| Compound Name | 3-methyl-1-(3-phenyl-1H-pyrazolo[3,4-c]pyridin-5-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71253361 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-methyl-1-(3-phenyl-1H-pyrazolo[3,4-c]pyridin-5-yl)imidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(c2cc3c(-c4ccccc4)n[nH]c3cn2)C1=O |
| InChI | InChI=1S/C16H13N5O2/c1-20-14(22)9-21(16(20)23)13-7-11-12(8-17-13)18-19-15(11)10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | AHWQQJHQLQVNAY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|