C24H33N5O3S — CID 71259748
N-[1-(3-ethoxypropyl)-2-(thiophen-2-ylcarbamoylamino)benzimidazol-5-yl]-2-ethyl-N-methylbutanamide (PubChem CID 71259748) has the molecular formula C24H33N5O3S and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[1-(3-ethoxypropyl)-2-(thiophen-2-ylcarbamoylamino)benzimidazol-5-yl]-2-ethyl-N-methylbutanamide.
| Compound Name | N-[1-(3-ethoxypropyl)-2-(thiophen-2-ylcarbamoylamino)benzimidazol-5-yl]-2-ethyl-N-methylbutanamide |
|---|---|
| PubChem CID | 71259748 |
| Molecular Formula | C24H33N5O3S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | N-[1-(3-ethoxypropyl)-2-(thiophen-2-ylcarbamoylamino)benzimidazol-5-yl]-2-ethyl-N-methylbutanamide |
| SMILES | CCOCCCn1c(NC(=O)Nc2cccs2)nc2cc(N(C)C(=O)C(CC)CC)ccc21 |
| InChI | InChI=1S/C24H33N5O3S/c1-5-17(6-2)22(30)28(4)18-11-12-20-19(16-18)25-23(29(20)13-9-14-32-7-3)27-24(31)26-21-10-8-15-33-21/h8,10-12,15-17H,5-7,9,13-14H2,1-4H3,(H2,25,26,27,31) |
| InChIKey | CXLXVLFKLFJPCF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|