C22H28N4OS — CID 71262917
[4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-[4-(1,2-thiazolidin-2-ylmethyl)phenyl]methanone (PubChem CID 71262917) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-[4-(1,2-thiazolidin-2-ylmethyl)phenyl]methanone.
| Compound Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-[4-(1,2-thiazolidin-2-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 71262917 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [4-(3,5-dimethyl-2-pyridinyl)piperazin-1-yl]-[4-(1,2-thiazolidin-2-ylmethyl)phenyl]methanone |
| SMILES | Cc1cnc(N2CCN(C(=O)c3ccc(CN4CCCS4)cc3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H28N4OS/c1-17-14-18(2)21(23-15-17)24-9-11-25(12-10-24)22(27)20-6-4-19(5-7-20)16-26-8-3-13-28-26/h4-7,14-15H,3,8-13,16H2,1-2H3 |
| InChIKey | FYLJGUPLFQFEER-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|