C19H19N7O2 — CID 71267375
N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-6-(1H-pyrazol-4-yl)-1H-indazole-3-carboxamide (PubChem CID 71267375) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-6-(1H-pyrazol-4-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-6-(1H-pyrazol-4-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 71267375 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-6-(1H-pyrazol-4-yl)-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(CC2CCCO2)c1)c1n[nH]c2cc(-c3cn[nH]c3)ccc12 |
| InChI | InChI=1S/C19H19N7O2/c27-19(23-14-9-22-26(10-14)11-15-2-1-5-28-15)18-16-4-3-12(6-17(16)24-25-18)13-7-20-21-8-13/h3-4,6-10,15H,1-2,5,11H2,(H,20,21)(H,23,27)(H,24,25) |
| InChIKey | XXGAWTQCKKHVMZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |