C24H29BrN2O3 — CID 71270769
tert-butyl (3S)-3-[[benzyl-(4-bromobenzoyl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 71270769) has the molecular formula C24H29BrN2O3 and a molecular weight of 473.41 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[benzyl-(4-bromobenzoyl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[benzyl-(4-bromobenzoyl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71270769 |
| Molecular Formula | C24H29BrN2O3 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | tert-butyl (3S)-3-[[benzyl-(4-bromobenzoyl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CN(Cc2ccccc2)C(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C24H29BrN2O3/c1-24(2,3)30-23(29)26-14-13-19(16-26)17-27(15-18-7-5-4-6-8-18)22(28)20-9-11-21(25)12-10-20/h4-12,19H,13-17H2,1-3H3/t19-/m1/s1 |
| InChIKey | XLVCWTXETVUMRN-LJQANCHMSA-N |
| XLogP | 5.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |