C13H12F2N2O3 — CID 71272055
5-[2-[4-(difluoromethoxy)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione (PubChem CID 71272055) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5-[2-[4-(difluoromethoxy)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione.
| Compound Name | 5-[2-[4-(difluoromethoxy)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione |
|---|---|
| PubChem CID | 71272055 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-[2-[4-(difluoromethoxy)phenyl]ethyl]-1,2-dihydropyridazine-3,4-dione |
| SMILES | O=c1[nH][nH]cc(CCc2ccc(OC(F)F)cc2)c1=O |
| InChI | InChI=1S/C13H12F2N2O3/c14-13(15)20-10-5-2-8(3-6-10)1-4-9-7-16-17-12(19)11(9)18/h2-3,5-7,13H,1,4H2,(H,16,18)(H,17,19) |
| InChIKey | XHARJBTVMQWJSE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|