C31H37F3N6O3Si — CID 71272714
N-methyl-2-[[2-(6-morpholin-4-yl-3-pyridinyl)-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]benzamide (PubChem CID 71272714) has the molecular formula C31H37F3N6O3Si and a molecular weight of 626.76 g/mol. Its IUPAC name is N-methyl-2-[[2-(6-morpholin-4-yl-3-pyridinyl)-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]benzamide.
| Compound Name | N-methyl-2-[[2-(6-morpholin-4-yl-3-pyridinyl)-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 71272714 |
| Molecular Formula | C31H37F3N6O3Si |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | N-methyl-2-[[2-(6-morpholin-4-yl-3-pyridinyl)-5-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]benzamide |
| SMILES | CNC(=O)c1ccccc1Nc1c(C(F)(F)F)cnc2c1cc(-c1ccc(N3CCOCC3)nc1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C31H37F3N6O3Si/c1-35-30(41)22-7-5-6-8-25(22)38-28-23-17-26(21-9-10-27(36-18-21)39-11-13-42-14-12-39)40(20-43-15-16-44(2,3)4)29(23)37-19-24(28)31(32,33)34/h5-10,17-19H,11-16,20H2,1-4H3,(H,35,41)(H,37,38) |
| InChIKey | WSUOFTOPZQFWIS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|