C65H52N4 — CID 71276700
2-[2',7'-ditert-butyl-7-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine (PubChem CID 71276700) has the molecular formula C65H52N4 and a molecular weight of 889.16 g/mol. Its IUPAC name is 2-[2',7'-ditert-butyl-7-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[2',7'-ditert-butyl-7-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 71276700 |
| Molecular Formula | C65H52N4 |
| Molecular Weight | 889.16 g/mol |
| Exact Mass | 888.42 |
| IUPAC Name | 2-[2',7'-ditert-butyl-7-(4,6-diphenylpyrimidin-2-yl)-9,9'-spirobi[fluorene]-2-yl]-4,6-diphenylpyrimidine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)ccc3-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C65H52N4/c1-63(2,3)47-29-33-51-52-34-30-48(64(4,5)6)38-56(52)65(55(51)37-47)53-35-45(61-66-57(41-19-11-7-12-20-41)39-58(67-61)42-21-13-8-14-22-42)27-31-49(53)50-32-28-46(36-54(50)65)62-68-59(43-23-15-9-16-24-43)40-60(69-62)44-25-17-10-18-26-44/h7-40H,1-6H3 |
| InChIKey | ISMWQBKNPATLGU-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.16 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |