C24H25N9O2 — CID 71276873
2-amino-6,6-dimethyl-N-[1-(1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-5,11-dihydropyrimido[4,5-a]carbazole-8-carboxamide (PubChem CID 71276873) has the molecular formula C24H25N9O2 and a molecular weight of 471.53 g/mol. Its IUPAC name is 2-amino-6,6-dimethyl-N-[1-(1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-5,11-dihydropyrimido[4,5-a]carbazole-8-carboxamide.
| Compound Name | 2-amino-6,6-dimethyl-N-[1-(1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-5,11-dihydropyrimido[4,5-a]carbazole-8-carboxamide |
|---|---|
| PubChem CID | 71276873 |
| Molecular Formula | C24H25N9O2 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 2-amino-6,6-dimethyl-N-[1-(1H-1,2,4-triazole-5-carbonyl)pyrrolidin-3-yl]-5,11-dihydropyrimido[4,5-a]carbazole-8-carboxamide |
| SMILES | CC1(C)Cc2cnc(N)nc2-c2[nH]c3ccc(C(=O)NC4CCN(C(=O)c5ncn[nH]5)C4)cc3c21 |
| InChI | InChI=1S/C24H25N9O2/c1-24(2)8-13-9-26-23(25)31-18(13)19-17(24)15-7-12(3-4-16(15)30-19)21(34)29-14-5-6-33(10-14)22(35)20-27-11-28-32-20/h3-4,7,9,11,14,30H,5-6,8,10H2,1-2H3,(H,29,34)(H2,25,26,31)(H,27,28,32) |
| InChIKey | ADUANOYWCMGKRM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |