C21H16ClN3O3S — CID 71281502
3-(4-chlorophenyl)sulfanyl-N-[(3,4-dihydroxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 71281502) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[(3,4-dihydroxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[(3,4-dihydroxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71281502 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[(3,4-dihydroxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(O)c(O)c1)c1[nH]c2ncccc2c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c22-13-4-6-14(7-5-13)29-19-15-2-1-9-23-20(15)25-18(19)21(28)24-11-12-3-8-16(26)17(27)10-12/h1-10,26-27H,11H2,(H,23,25)(H,24,28) |
| InChIKey | UYWDVHNQKVXGAX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|