C28H25Cl2NO4S — CID 71285870
N-[3-chloro-3-(4-chlorophenoxy)-4-phenylcyclohexa-1,5-dien-1-yl]-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 71285870) has the molecular formula C28H25Cl2NO4S and a molecular weight of 542.48 g/mol. Its IUPAC name is N-[3-chloro-3-(4-chlorophenoxy)-4-phenylcyclohexa-1,5-dien-1-yl]-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-[3-chloro-3-(4-chlorophenoxy)-4-phenylcyclohexa-1,5-dien-1-yl]-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 71285870 |
| Molecular Formula | C28H25Cl2NO4S |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | N-[3-chloro-3-(4-chlorophenoxy)-4-phenylcyclohexa-1,5-dien-1-yl]-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)NC2=CC(Cl)(Oc3ccc(Cl)cc3)C(c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C28H25Cl2NO4S/c1-2-36(33,34)25-15-8-20(9-16-25)18-27(32)31-23-12-17-26(21-6-4-3-5-7-21)28(30,19-23)35-24-13-10-22(29)11-14-24/h3-17,19,26H,2,18H2,1H3,(H,31,32) |
| InChIKey | BRBSLWIMYFXZJB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|