C17H26NO3- — CID 7128707
(2R)-2-(adamantane-1-carbonylamino)-4-methylpentanoate (PubChem CID 7128707) has the molecular formula C17H26NO3- and a molecular weight of 292.40 g/mol. Its IUPAC name is (2R)-2-(adamantane-1-carbonylamino)-4-methylpentanoate.
| Compound Name | (2R)-2-(adamantane-1-carbonylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 7128707 |
| Molecular Formula | C17H26NO3- |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2R)-2-(adamantane-1-carbonylamino)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)[O-] |
| InChI | InChI=1S/C17H27NO3/c1-10(2)3-14(15(19)20)18-16(21)17-7-11-4-12(8-17)6-13(5-11)9-17/h10-14H,3-9H2,1-2H3,(H,18,21)(H,19,20)/p-1/t11?,12?,13?,14-,17?/m1/s1 |
| InChIKey | JOUXQDDDDNUCGU-DLUQRMLASA-M |
| XLogP | 1.48 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |