C15H19N4O+ — CID 7129008
(3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazin-4-ium-2-one (PubChem CID 7129008) has the molecular formula C15H19N4O+ and a molecular weight of 271.34 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazin-4-ium-2-one.
| Compound Name | (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazin-4-ium-2-one |
|---|---|
| PubChem CID | 7129008 |
| Molecular Formula | C15H19N4O+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (3R)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)piperazin-4-ium-2-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@H]1[NH2+]CCNC1=O |
| InChI | InChI=1S/C15H18N4O/c1-10-13(14-15(20)17-9-8-16-14)11(2)19(18-10)12-6-4-3-5-7-12/h3-7,14,16H,8-9H2,1-2H3,(H,17,20)/p+1/t14-/m1/s1 |
| InChIKey | VJMTUHWRCZDCDW-CQSZACIVSA-O |
| XLogP | 0.22 |
| TPSA | 63.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |