C40H54N2O4 — CID 71293755
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 71293755) has the molecular formula C40H54N2O4 and a molecular weight of 626.88 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 71293755 |
| Molecular Formula | C40H54N2O4 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.41 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[2-(6-methoxynaphthalen-2-yl)propanoylamino]ethoxy]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOCCNC(=O)C(C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C40H54N2O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-39(43)41-28-30-46-31-29-42-40(44)34(2)35-24-25-37-33-38(45-3)27-26-36(37)32-35/h5-6,8-9,11-12,14-15,17-18,20-21,24-27,32-34H,4,7,10,13,16,19,22-23,28-31H2,1-3H3,(H,41,43)(H,42,44)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | FWEHMGWLXFSZKZ-YNUSHXQLSA-N |
| XLogP | 8.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|