C20H11N3O2S2 — CID 71299854
4-[(5E)-5-[2-(1H-indol-3-yl)-2-oxoethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzonitrile (PubChem CID 71299854) has the molecular formula C20H11N3O2S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[(5E)-5-[2-(1H-indol-3-yl)-2-oxoethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzonitrile.
| Compound Name | 4-[(5E)-5-[2-(1H-indol-3-yl)-2-oxoethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 71299854 |
| Molecular Formula | C20H11N3O2S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 4-[(5E)-5-[2-(1H-indol-3-yl)-2-oxoethylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)/C(=C\C(=O)c3c[nH]c4ccccc34)SC2=S)cc1 |
| InChI | InChI=1S/C20H11N3O2S2/c21-10-12-5-7-13(8-6-12)23-19(25)18(27-20(23)26)9-17(24)15-11-22-16-4-2-1-3-14(15)16/h1-9,11,22H/b18-9+ |
| InChIKey | DGUJHESWCOFPJQ-GIJQJNRQSA-N |
| XLogP | 4.17 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|