C9H9NO2 — CID 71302009
4a,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 71302009) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 4a,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 4a,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 71302009 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4a,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | O=C1C=CC2C(=O)CCCC2=N1 |
| InChI | InChI=1S/C9H9NO2/c11-8-3-1-2-7-6(8)4-5-9(12)10-7/h4-6H,1-3H2 |
| InChIKey | GPSCNDMKHPUQRW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |