C7H10ClN3S — CID 71303951
6-chloro-5-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 71303951) has the molecular formula C7H10ClN3S and a molecular weight of 203.70 g/mol. Its IUPAC name is 6-chloro-5-ethyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-ethyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 71303951 |
| Molecular Formula | C7H10ClN3S |
| Molecular Weight | 203.70 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 6-chloro-5-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCc1c(N)nc(SC)nc1Cl |
| InChI | InChI=1S/C7H10ClN3S/c1-3-4-5(8)10-7(12-2)11-6(4)9/h3H2,1-2H3,(H2,9,10,11) |
| InChIKey | YLCWKOLBVHPENA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |