C7H10N5O2+ — CID 71304003
7-amino-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 71304003) has the molecular formula C7H10N5O2+ and a molecular weight of 196.19 g/mol. Its IUPAC name is 7-amino-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-amino-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 71304003 |
| Molecular Formula | C7H10N5O2+ |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 7-amino-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC=[N+]2N)N(C)C1=O |
| InChI | InChI=1S/C7H10N5O2/c1-10-5-4(12(8)3-9-5)6(13)11(2)7(10)14/h3-4H,8H2,1-2H3/q+1 |
| InChIKey | VEPWFNPZCWPNJG-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|