C12H23O13PS — CID 71304802
[(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]sulfanyloxan-2-yl]methyl dihydrogen phosphate (PubChem CID 71304802) has the molecular formula C12H23O13PS and a molecular weight of 438.34 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]sulfanyloxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]sulfanyloxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71304802 |
| Molecular Formula | C12H23O13PS |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]sulfanyloxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@@H]1O[C@@H](S[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O13PS/c13-1-3-10(7(16)8(17)11(19)24-3)27-12-9(18)6(15)5(14)4(25-12)2-23-26(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3-,4+,5-,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | XGJJBBUPFWZKFA-GABYZZBISA-N |
| XLogP | -4.56 |
| TPSA | 226.83 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|