C15H20NS+ — CID 7130716
[(R)-[4-[(2R)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]azanium (PubChem CID 7130716) has the molecular formula C15H20NS+ and a molecular weight of 246.40 g/mol. Its IUPAC name is [(R)-[4-[(2R)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]azanium.
| Compound Name | [(R)-[4-[(2R)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 7130716 |
| Molecular Formula | C15H20NS+ |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(R)-[4-[(2R)-butan-2-yl]phenyl]-thiophen-2-ylmethyl]azanium |
| SMILES | CC[C@@H](C)c1ccc([C@@H]([NH3+])c2cccs2)cc1 |
| InChI | InChI=1S/C15H19NS/c1-3-11(2)12-6-8-13(9-7-12)15(16)14-5-4-10-17-14/h4-11,15H,3,16H2,1-2H3/p+1/t11-,15-/m1/s1 |
| InChIKey | VBDAKYDKBDGKNF-IAQYHMDHSA-O |
| XLogP | 3.59 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |