C5H7F5O — CID 71308977
1,1,2,2,3,3-hexadeuterio-4,4,5,5,5-pentafluoropentan-1-ol (PubChem CID 71308977) has the molecular formula C5H7F5O and a molecular weight of 184.14 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexadeuterio-4,4,5,5,5-pentafluoropentan-1-ol.
| Compound Name | 1,1,2,2,3,3-hexadeuterio-4,4,5,5,5-pentafluoropentan-1-ol |
|---|---|
| PubChem CID | 71308977 |
| Molecular Formula | C5H7F5O |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1,1,2,2,3,3-hexadeuterio-4,4,5,5,5-pentafluoropentan-1-ol |
| SMILES | [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H7F5O/c6-4(7,2-1-3-11)5(8,9)10/h11H,1-3H2/i1D2,2D2,3D2 |
| InChIKey | QROUUECTKRZFHF-NMFSSPJFSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|