About Ammonium-d4 acetate, 98 atom % D
Ammonium-d4 acetate, 98 atom % D (PubChem CID 71310296) has the molecular formula C2H7NO2
and a molecular weight of 81.11 g/mol.
Molecular Properties
| Compound Name | Ammonium-d4 acetate, 98 atom % D |
| PubChem CID | 71310296 |
| Molecular Formula | C2H7NO2 |
| Molecular Weight | 81.11 g/mol |
| Exact Mass | 81.07 |
| IUPAC Name | — |
| SMILES | [2H]N([2H])[2H].[2H]OC(C)=O |
| InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i/hD4 |
| InChIKey | USFZMSVCRYTOJT-JBISRTOLSA-N |
| XLogP | 0.25 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.11 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ammonium-d4 acetate, 98 atom % D with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ammonium-d4 acetate, 98 atom % D?
The IUPAC name of Ammonium-d4 acetate, 98 atom % D (CID 71310296) is not available.
What is the SMILES notation for Ammonium-d4 acetate, 98 atom % D?
The canonical SMILES for Ammonium-d4 acetate, 98 atom % D is [2H]N([2H])[2H].[2H]OC(C)=O.
What is the InChIKey of Ammonium-d4 acetate, 98 atom % D?
The InChIKey is USFZMSVCRYTOJT-JBISRTOLSA-N. The full InChI is InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i/hD4.
What are the key properties of Ammonium-d4 acetate, 98 atom % D?
Ammonium-d4 acetate, 98 atom % D has a molecular weight of 81.11 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ammonium-d4 acetate, 98 atom % D is sourced from PubChem (CID 71310296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).