C13H20IrO2 — CID 71310569
(1Z,5Z)-cycloocta-1,5-diene;(E)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 71310569) has the molecular formula C13H20IrO2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1Z,5Z)-cycloocta-1,5-diene;(E)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | (1Z,5Z)-cycloocta-1,5-diene;(E)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 71310569 |
| Molecular Formula | C13H20IrO2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;(E)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | C1=C\CC/C=C\CC/1.CC(=O)/C=C(\C)O.[Ir] |
| InChI | InChI=1S/C8H12.C5H8O2.Ir/c1-2-4-6-8-7-5-3-1;1-4(6)3-5(2)7;/h1-2,7-8H,3-6H2;3,6H,1-2H3;/b2-1-,8-7-;4-3+; |
| InChIKey | CXVDVPYBQMSIAP-ZJSCHYLOSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|