C6H20N6 — CID 71311311
hexane-1,2,3,4,5,6-hexamine (PubChem CID 71311311) has the molecular formula C6H20N6 and a molecular weight of 176.27 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexamine.
| Compound Name | hexane-1,2,3,4,5,6-hexamine |
|---|---|
| PubChem CID | 71311311 |
| Molecular Formula | C6H20N6 |
| Molecular Weight | 176.27 g/mol |
| Exact Mass | 176.17 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexamine |
| SMILES | NCC(N)C(N)C(N)C(N)CN |
| InChI | InChI=1S/C6H20N6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6H,1-2,7-12H2 |
| InChIKey | PIJGCIFQPQGTTG-UHFFFAOYSA-N |
| XLogP | -3.79 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.27 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |