C20H19ClN2O9 — CID 71315626
(4Z,4aS,5aS,6S,12aS)-3,6,10,11,12a-pentahydroxy-4-hydroxyimino-6-methyl-1,12-dioxo-5,5a-dihydro-4aH-tetracene-2-carboxamide;hydrochloride (PubChem CID 71315626) has the molecular formula C20H19ClN2O9 and a molecular weight of 466.83 g/mol. Its IUPAC name is (4Z,4aS,5aS,6S,12aS)-3,6,10,11,12a-pentahydroxy-4-hydroxyimino-6-methyl-1,12-dioxo-5,5a-dihydro-4aH-tetracene-2-carboxamide;hydrochloride.
| Compound Name | (4Z,4aS,5aS,6S,12aS)-3,6,10,11,12a-pentahydroxy-4-hydroxyimino-6-methyl-1,12-dioxo-5,5a-dihydro-4aH-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 71315626 |
| Molecular Formula | C20H19ClN2O9 |
| Molecular Weight | 466.83 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (4Z,4aS,5aS,6S,12aS)-3,6,10,11,12a-pentahydroxy-4-hydroxyimino-6-methyl-1,12-dioxo-5,5a-dihydro-4aH-tetracene-2-carboxamide;hydrochloride |
| SMILES | C[C@@]1(O)c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(=O)C(C(N)=O)=C(O)/C(=N\O)[C@@H]3C[C@@H]21.Cl |
| InChI | InChI=1S/C20H18N2O9.ClH/c1-19(29)6-3-2-4-9(23)10(6)14(24)11-7(19)5-8-13(22-31)15(25)12(18(21)28)17(27)20(8,30)16(11)26;/h2-4,7-8,23-25,29-31H,5H2,1H3,(H2,21,28);1H/b22-13-;/t7-,8-,19+,20-;/m0./s1 |
| InChIKey | QCYCRJUYHBFEEG-WIAULQMCSA-N |
| XLogP | -0.05 |
| TPSA | 210.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.83 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|