C15H9BrCl2O — CID 71315967
2-bromo-1-(2,7-dichloro-9H-fluoren-4-yl)ethanone (PubChem CID 71315967) has the molecular formula C15H9BrCl2O and a molecular weight of 356.05 g/mol. Its IUPAC name is 2-bromo-1-(2,7-dichloro-9H-fluoren-4-yl)ethanone.
| Compound Name | 2-bromo-1-(2,7-dichloro-9H-fluoren-4-yl)ethanone |
|---|---|
| PubChem CID | 71315967 |
| Molecular Formula | C15H9BrCl2O |
| Molecular Weight | 356.05 g/mol |
| Exact Mass | 353.92 |
| IUPAC Name | 2-bromo-1-(2,7-dichloro-9H-fluoren-4-yl)ethanone |
| SMILES | O=C(CBr)c1cc(Cl)cc2c1-c1ccc(Cl)cc1C2 |
| InChI | InChI=1S/C15H9BrCl2O/c16-7-14(19)13-6-11(18)5-9-3-8-4-10(17)1-2-12(8)15(9)13/h1-2,4-6H,3,7H2 |
| InChIKey | DIAHHKVTQMIQJC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|