C10H10BrClO — CID 171008499
2-bromo-1-(5-chloro-2,3-dimethylphenyl)ethanone (PubChem CID 171008499) has the molecular formula C10H10BrClO and a molecular weight of 261.55 g/mol. Its IUPAC name is 2-bromo-1-(5-chloro-2,3-dimethylphenyl)ethanone.
| Compound Name | 2-bromo-1-(5-chloro-2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 171008499 |
| Molecular Formula | C10H10BrClO |
| Molecular Weight | 261.55 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2-bromo-1-(5-chloro-2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cc(Cl)cc(C(=O)CBr)c1C |
| InChI | InChI=1S/C10H10BrClO/c1-6-3-8(12)4-9(7(6)2)10(13)5-11/h3-4H,5H2,1-2H3 |
| InChIKey | RSKAVFLXMBKQCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|