C10H11BrO2 — CID 53441682
2-bromo-1-(2-hydroxy-4,5-dimethylphenyl)ethanone (PubChem CID 53441682) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 2-bromo-1-(2-hydroxy-4,5-dimethylphenyl)ethanone.
| Compound Name | 2-bromo-1-(2-hydroxy-4,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 53441682 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-bromo-1-(2-hydroxy-4,5-dimethylphenyl)ethanone |
| SMILES | Cc1cc(O)c(C(=O)CBr)cc1C |
| InChI | InChI=1S/C10H11BrO2/c1-6-3-8(10(13)5-11)9(12)4-7(6)2/h3-4,12H,5H2,1-2H3 |
| InChIKey | GHGPAYHRBSHYHZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|