C10H14ClNO — CID 142017743
5-chloro-1,2-dimethyl-3-nitrosobenzene;ethane (PubChem CID 142017743) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 5-chloro-1,2-dimethyl-3-nitrosobenzene;ethane.
| Compound Name | 5-chloro-1,2-dimethyl-3-nitrosobenzene;ethane |
|---|---|
| PubChem CID | 142017743 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-chloro-1,2-dimethyl-3-nitrosobenzene;ethane |
| SMILES | CC.Cc1cc(Cl)cc(N=O)c1C |
| InChI | InChI=1S/C8H8ClNO.C2H6/c1-5-3-7(9)4-8(10-11)6(5)2;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | FGJRONPLLYZVTC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |