C13H18ClN — CID 123980375
N-tert-butyl-1-(5-chloro-2,3-dimethylphenyl)methanimine (PubChem CID 123980375) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is N-tert-butyl-1-(5-chloro-2,3-dimethylphenyl)methanimine.
| Compound Name | N-tert-butyl-1-(5-chloro-2,3-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 123980375 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-tert-butyl-1-(5-chloro-2,3-dimethylphenyl)methanimine |
| SMILES | Cc1cc(Cl)cc(/C=N/C(C)(C)C)c1C |
| InChI | InChI=1S/C13H18ClN/c1-9-6-12(14)7-11(10(9)2)8-15-13(3,4)5/h6-8H,1-5H3/b15-8+ |
| InChIKey | SQPLLRKERDIGQC-OVCLIPMQSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|