C18H22O5S — CID 71316494
[(8R,9S,13S,14S)-6,6,7,7,11-pentadeuterio-13-methyl-17-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 71316494) has the molecular formula C18H22O5S and a molecular weight of 355.47 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-6,6,7,7,11-pentadeuterio-13-methyl-17-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(8R,9S,13S,14S)-6,6,7,7,11-pentadeuterio-13-methyl-17-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71316494 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [(8R,9S,13S,14S)-6,6,7,7,11-pentadeuterio-13-methyl-17-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | [2H]C1C[C@]2(C)C(=O)CC[C@H]2[C@H]2[C@H]1c1ccc(OS(=O)(=O)O)cc1C([2H])([2H])C2([2H])[2H] |
| InChI | InChI=1S/C18H22O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-16H,2,4,6-9H2,1H3,(H,20,21,22)/t14-,15-,16+,18+/m1/s1/i2D2,4D2,8D/t8?,14-,15-,16+,18+ |
| InChIKey | JKKFKPJIXZFSSB-GHBIIUGDSA-N |
| XLogP | 3.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|