C20H20P+ — CID 71316676
1,1,2,2,2-pentadeuterioethyl(triphenyl)phosphanium (PubChem CID 71316676) has the molecular formula C20H20P+ and a molecular weight of 296.38 g/mol. Its IUPAC name is 1,1,2,2,2-pentadeuterioethyl(triphenyl)phosphanium.
| Compound Name | 1,1,2,2,2-pentadeuterioethyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 71316676 |
| Molecular Formula | C20H20P+ |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethyl(triphenyl)phosphanium |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20P/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,2H2,1H3/q+1/i1D3,2D2 |
| InChIKey | GELSOTNVVKOYAW-ZBJDZAJPSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|