C16H27NO — CID 71320410
1-piperidin-1-ylundeca-3,4-dien-1-one (PubChem CID 71320410) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-piperidin-1-ylundeca-3,4-dien-1-one.
| Compound Name | 1-piperidin-1-ylundeca-3,4-dien-1-one |
|---|---|
| PubChem CID | 71320410 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-piperidin-1-ylundeca-3,4-dien-1-one |
| SMILES | CCCCCCC=C=CCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H27NO/c1-2-3-4-5-6-7-8-10-13-16(18)17-14-11-9-12-15-17/h7,10H,2-6,9,11-15H2,1H3 |
| InChIKey | BNPXKKXWRUUSTE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|