C10H18O2Si — CID 71320568
3-trimethylsilylhept-3-ene-2,5-dione (PubChem CID 71320568) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is 3-trimethylsilylhept-3-ene-2,5-dione.
| Compound Name | 3-trimethylsilylhept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 71320568 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-trimethylsilylhept-3-ene-2,5-dione |
| SMILES | CCC(=O)C=C(C(C)=O)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O2Si/c1-6-9(12)7-10(8(2)11)13(3,4)5/h7H,6H2,1-5H3 |
| InChIKey | XNJSXNTZANWHRW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|