C17H16ClN5 — CID 713222
6-chloro-2-N,4-N-bis(2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 713222) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is 6-chloro-2-N,4-N-bis(2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N,4-N-bis(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 713222 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-chloro-2-N,4-N-bis(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nc(Cl)nc(Nc2ccccc2C)n1 |
| InChI | InChI=1S/C17H16ClN5/c1-11-7-3-5-9-13(11)19-16-21-15(18)22-17(23-16)20-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | OUERFDZIKTYURG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |