C13H8N2O2 — CID 71330019
5-naphthalen-2-ylimidazole-2,4-dione (PubChem CID 71330019) has the molecular formula C13H8N2O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-naphthalen-2-ylimidazole-2,4-dione.
| Compound Name | 5-naphthalen-2-ylimidazole-2,4-dione |
|---|---|
| PubChem CID | 71330019 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 5-naphthalen-2-ylimidazole-2,4-dione |
| SMILES | O=C1N=C(c2ccc3ccccc3c2)C(=O)N1 |
| InChI | InChI=1S/C13H8N2O2/c16-12-11(14-13(17)15-12)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,15,16,17) |
| InChIKey | AJJFNAYTDITNLQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |