C12H7NOS2 — CID 71596669
5-naphthalen-2-yl-1,2,4-dithiazol-3-one (PubChem CID 71596669) has the molecular formula C12H7NOS2 and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-naphthalen-2-yl-1,2,4-dithiazol-3-one.
| Compound Name | 5-naphthalen-2-yl-1,2,4-dithiazol-3-one |
|---|---|
| PubChem CID | 71596669 |
| Molecular Formula | C12H7NOS2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 5-naphthalen-2-yl-1,2,4-dithiazol-3-one |
| SMILES | O=c1nc(-c2ccc3ccccc3c2)ss1 |
| InChI | InChI=1S/C12H7NOS2/c14-12-13-11(15-16-12)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | ABMSAPBTYSUSNJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |