C9H12N5O12P3+2 — CID 71333532
[5-(5-azido-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium (PubChem CID 71333532) has the molecular formula C9H12N5O12P3+2 and a molecular weight of 475.14 g/mol. Its IUPAC name is [5-(5-azido-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium.
| Compound Name | [5-(5-azido-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 71333532 |
| Molecular Formula | C9H12N5O12P3+2 |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | [5-(5-azido-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium |
| SMILES | [N-]=[N+]=Nc1cn(C2CC(O)C(CO[P+](=O)OP(=O)(O)O[P+](=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10N5O12P3/c10-13-12-4-2-14(9(17)11-8(4)16)7-1-5(15)6(24-7)3-23-28(20)26-29(21,22)25-27(18)19/h2,5-7,15H,1,3H2,(H-2,11,16,17,18,19,21,22)/p+2 |
| InChIKey | AWKNHHDDWLUOKQ-UHFFFAOYSA-P |
| XLogP | 0.58 |
| TPSA | 252.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|