About ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate
ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate (PubChem CID 71335436) has the molecular formula C8H12NO2S+
and a molecular weight of 186.26 g/mol. Its IUPAC name is ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate |
| PubChem CID | 71335436 |
| Molecular Formula | C8H12NO2S+ |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate |
| SMILES | CCOC(=O)c1sc[n+](C)c1C |
| InChI | InChI=1S/C8H12NO2S/c1-4-11-8(10)7-6(2)9(3)5-12-7/h5H,4H2,1-3H3/q+1 |
| InChIKey | DYQFPMXSTMUULI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate?
The IUPAC name of ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate (CID 71335436) is ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate.
What is the SMILES notation for ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate?
The canonical SMILES for ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate is CCOC(=O)c1sc[n+](C)c1C.
What is the InChIKey of ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate?
The InChIKey is DYQFPMXSTMUULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12NO2S/c1-4-11-8(10)7-6(2)9(3)5-12-7/h5H,4H2,1-3H3/q+1.
What are the key properties of ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate?
ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate has a molecular weight of 186.26 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,4-dimethyl-1,3-thiazol-3-ium-5-carboxylate is sourced from PubChem (CID 71335436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).